C10H3BrF5N3O — CID 102855079
1-[1-(5-bromo-2,4-difluorophenyl)triazol-4-yl]-2,2,2-trifluoroethanone (PubChem CID 102855079) has the molecular formula C10H3BrF5N3O and a molecular weight of 356.05 g/mol. Its IUPAC name is 1-[1-(5-bromo-2,4-difluorophenyl)triazol-4-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[1-(5-bromo-2,4-difluorophenyl)triazol-4-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 102855079 |
| Molecular Formula | C10H3BrF5N3O |
| Molecular Weight | 356.05 g/mol |
| Exact Mass | 354.94 |
| IUPAC Name | 1-[1-(5-bromo-2,4-difluorophenyl)triazol-4-yl]-2,2,2-trifluoroethanone |
| SMILES | O=C(c1cn(-c2cc(Br)c(F)cc2F)nn1)C(F)(F)F |
| InChI | InChI=1S/C10H3BrF5N3O/c11-4-1-8(6(13)2-5(4)12)19-3-7(17-18-19)9(20)10(14,15)16/h1-3H |
| InChIKey | LCVAEGQEXGSEHY-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.05 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|