C9H5BrClF2N3 — CID 102855059
1-(5-bromo-2,4-difluorophenyl)-4-(chloromethyl)triazole (PubChem CID 102855059) has the molecular formula C9H5BrClF2N3 and a molecular weight of 308.51 g/mol. Its IUPAC name is 1-(5-bromo-2,4-difluorophenyl)-4-(chloromethyl)triazole.
| Compound Name | 1-(5-bromo-2,4-difluorophenyl)-4-(chloromethyl)triazole |
|---|---|
| PubChem CID | 102855059 |
| Molecular Formula | C9H5BrClF2N3 |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 306.93 |
| IUPAC Name | 1-(5-bromo-2,4-difluorophenyl)-4-(chloromethyl)triazole |
| SMILES | Fc1cc(F)c(-n2cc(CCl)nn2)cc1Br |
| InChI | InChI=1S/C9H5BrClF2N3/c10-6-1-9(8(13)2-7(6)12)16-4-5(3-11)14-15-16/h1-2,4H,3H2 |
| InChIKey | WZWDEJKGSHRYCS-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|