C17H26ClFN2 — CID 102856195
N-[[1-[(3-chloro-2-fluorophenyl)methyl]piperidin-4-yl]methyl]-2-methylpropan-2-amine (PubChem CID 102856195) has the molecular formula C17H26ClFN2 and a molecular weight of 312.86 g/mol. Its IUPAC name is N-[[1-[(3-chloro-2-fluorophenyl)methyl]piperidin-4-yl]methyl]-2-methylpropan-2-amine.
| Compound Name | N-[[1-[(3-chloro-2-fluorophenyl)methyl]piperidin-4-yl]methyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 102856195 |
| Molecular Formula | C17H26ClFN2 |
| Molecular Weight | 312.86 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | N-[[1-[(3-chloro-2-fluorophenyl)methyl]piperidin-4-yl]methyl]-2-methylpropan-2-amine |
| SMILES | CC(C)(C)NCC1CCN(Cc2cccc(Cl)c2F)CC1 |
| InChI | InChI=1S/C17H26ClFN2/c1-17(2,3)20-11-13-7-9-21(10-8-13)12-14-5-4-6-15(18)16(14)19/h4-6,13,20H,7-12H2,1-3H3 |
| InChIKey | CGHLMFLCBBVACX-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.86 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |