C14H18Br2ClN — CID 102860014
N-[(4-bromo-2-chlorophenyl)methyl]-N-(3-bromopropyl)cyclobutanamine (PubChem CID 102860014) has the molecular formula C14H18Br2ClN and a molecular weight of 395.57 g/mol. Its IUPAC name is N-[(4-bromo-2-chlorophenyl)methyl]-N-(3-bromopropyl)cyclobutanamine.
| Compound Name | N-[(4-bromo-2-chlorophenyl)methyl]-N-(3-bromopropyl)cyclobutanamine |
|---|---|
| PubChem CID | 102860014 |
| Molecular Formula | C14H18Br2ClN |
| Molecular Weight | 395.57 g/mol |
| Exact Mass | 392.95 |
| IUPAC Name | N-[(4-bromo-2-chlorophenyl)methyl]-N-(3-bromopropyl)cyclobutanamine |
| SMILES | Clc1cc(Br)ccc1CN(CCCBr)C1CCC1 |
| InChI | InChI=1S/C14H18Br2ClN/c15-7-2-8-18(13-3-1-4-13)10-11-5-6-12(16)9-14(11)17/h5-6,9,13H,1-4,7-8,10H2 |
| InChIKey | HZBGIACREFMNDX-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.57 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|