C10H21F2N — CID 102868275
N-(1,1-difluoropropan-2-yl)heptan-2-amine (PubChem CID 102868275) has the molecular formula C10H21F2N and a molecular weight of 193.28 g/mol. Its IUPAC name is N-(1,1-difluoropropan-2-yl)heptan-2-amine.
| Compound Name | N-(1,1-difluoropropan-2-yl)heptan-2-amine |
|---|---|
| PubChem CID | 102868275 |
| Molecular Formula | C10H21F2N |
| Molecular Weight | 193.28 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | N-(1,1-difluoropropan-2-yl)heptan-2-amine |
| SMILES | CCCCCC(C)NC(C)C(F)F |
| InChI | InChI=1S/C10H21F2N/c1-4-5-6-7-8(2)13-9(3)10(11)12/h8-10,13H,4-7H2,1-3H3 |
| InChIKey | PKMYORMAVNDXFM-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.28 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|