C6H10ClF2N — CID 102870047
N-(2-chloroprop-2-enyl)-1,1-difluoropropan-2-amine (PubChem CID 102870047) has the molecular formula C6H10ClF2N and a molecular weight of 169.60 g/mol. Its IUPAC name is N-(2-chloroprop-2-enyl)-1,1-difluoropropan-2-amine.
| Compound Name | N-(2-chloroprop-2-enyl)-1,1-difluoropropan-2-amine |
|---|---|
| PubChem CID | 102870047 |
| Molecular Formula | C6H10ClF2N |
| Molecular Weight | 169.60 g/mol |
| Exact Mass | 169.05 |
| IUPAC Name | N-(2-chloroprop-2-enyl)-1,1-difluoropropan-2-amine |
| SMILES | C=C(Cl)CNC(C)C(F)F |
| InChI | InChI=1S/C6H10ClF2N/c1-4(7)3-10-5(2)6(8)9/h5-6,10H,1,3H2,2H3 |
| InChIKey | UOKJUKHXENPDJN-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.60 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |