C7H13F2N — CID 102870155
N-(1,1-difluoropropan-2-yl)-2-methylprop-2-en-1-amine (PubChem CID 102870155) has the molecular formula C7H13F2N and a molecular weight of 149.18 g/mol. Its IUPAC name is N-(1,1-difluoropropan-2-yl)-2-methylprop-2-en-1-amine.
| Compound Name | N-(1,1-difluoropropan-2-yl)-2-methylprop-2-en-1-amine |
|---|---|
| PubChem CID | 102870155 |
| Molecular Formula | C7H13F2N |
| Molecular Weight | 149.18 g/mol |
| Exact Mass | 149.10 |
| IUPAC Name | N-(1,1-difluoropropan-2-yl)-2-methylprop-2-en-1-amine |
| SMILES | C=C(C)CNC(C)C(F)F |
| InChI | InChI=1S/C7H13F2N/c1-5(2)4-10-6(3)7(8)9/h6-7,10H,1,4H2,2-3H3 |
| InChIKey | HWOVAKRJROTDHQ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.18 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|