C9H18ClN — CID 64568928
N-(2-chloroprop-2-enyl)-2,3-dimethylbutan-1-amine (PubChem CID 64568928) has the molecular formula C9H18ClN and a molecular weight of 175.70 g/mol. Its IUPAC name is N-(2-chloroprop-2-enyl)-2,3-dimethylbutan-1-amine.
| Compound Name | N-(2-chloroprop-2-enyl)-2,3-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 64568928 |
| Molecular Formula | C9H18ClN |
| Molecular Weight | 175.70 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | N-(2-chloroprop-2-enyl)-2,3-dimethylbutan-1-amine |
| SMILES | C=C(Cl)CNCC(C)C(C)C |
| InChI | InChI=1S/C9H18ClN/c1-7(2)8(3)5-11-6-9(4)10/h7-8,11H,4-6H2,1-3H3 |
| InChIKey | GWTYUNCSKYUZGD-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.70 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |