C13H22BrNO3S — CID 102872384
N-(3-bromopropyl)-N-cyclobutyl-1,1-dioxothiane-2-carboxamide (PubChem CID 102872384) has the molecular formula C13H22BrNO3S and a molecular weight of 352.29 g/mol. Its IUPAC name is N-(3-bromopropyl)-N-cyclobutyl-1,1-dioxothiane-2-carboxamide.
| Compound Name | N-(3-bromopropyl)-N-cyclobutyl-1,1-dioxothiane-2-carboxamide |
|---|---|
| PubChem CID | 102872384 |
| Molecular Formula | C13H22BrNO3S |
| Molecular Weight | 352.29 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | N-(3-bromopropyl)-N-cyclobutyl-1,1-dioxothiane-2-carboxamide |
| SMILES | O=C(C1CCCCS1(=O)=O)N(CCCBr)C1CCC1 |
| InChI | InChI=1S/C13H22BrNO3S/c14-8-4-9-15(11-5-3-6-11)13(16)12-7-1-2-10-19(12,17)18/h11-12H,1-10H2 |
| InChIKey | XSCHANYMAYLPHU-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.29 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|