C17H13BrClFN4O — CID 10287909
1-[3-(4-bromo-1-methylpyrazol-5-yl)-5-fluorophenyl]-3-(4-chlorophenyl)urea (PubChem CID 10287909) has the molecular formula C17H13BrClFN4O and a molecular weight of 423.67 g/mol. Its IUPAC name is 1-[3-(4-bromo-1-methylpyrazol-5-yl)-5-fluorophenyl]-3-(4-chlorophenyl)urea.
| Compound Name | 1-[3-(4-bromo-1-methylpyrazol-5-yl)-5-fluorophenyl]-3-(4-chlorophenyl)urea |
|---|---|
| PubChem CID | 10287909 |
| Molecular Formula | C17H13BrClFN4O |
| Molecular Weight | 423.67 g/mol |
| Exact Mass | 421.99 |
| IUPAC Name | 1-[3-(4-bromo-1-methylpyrazol-5-yl)-5-fluorophenyl]-3-(4-chlorophenyl)urea |
| SMILES | Cn1ncc(Br)c1-c1cc(F)cc(NC(=O)Nc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C17H13BrClFN4O/c1-24-16(15(18)9-21-24)10-6-12(20)8-14(7-10)23-17(25)22-13-4-2-11(19)3-5-13/h2-9H,1H3,(H2,22,23,25) |
| InChIKey | AEDYHLIXTWBKQX-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.67 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |