C20H20Cl2F2N4O2 — CID 10288457
3-amino-1-[3,5-dichloro-4-[5-[(2,4-difluorophenyl)methyl]-2-oxopiperidin-1-yl]phenyl]-1-methylurea (PubChem CID 10288457) has the molecular formula C20H20Cl2F2N4O2 and a molecular weight of 457.31 g/mol. Its IUPAC name is 3-amino-1-[3,5-dichloro-4-[5-[(2,4-difluorophenyl)methyl]-2-oxopiperidin-1-yl]phenyl]-1-methylurea.
| Compound Name | 3-amino-1-[3,5-dichloro-4-[5-[(2,4-difluorophenyl)methyl]-2-oxopiperidin-1-yl]phenyl]-1-methylurea |
|---|---|
| PubChem CID | 10288457 |
| Molecular Formula | C20H20Cl2F2N4O2 |
| Molecular Weight | 457.31 g/mol |
| Exact Mass | 456.09 |
| IUPAC Name | 3-amino-1-[3,5-dichloro-4-[5-[(2,4-difluorophenyl)methyl]-2-oxopiperidin-1-yl]phenyl]-1-methylurea |
| SMILES | CN(C(=O)NN)c1cc(Cl)c(N2CC(Cc3ccc(F)cc3F)CCC2=O)c(Cl)c1 |
| InChI | InChI=1S/C20H20Cl2F2N4O2/c1-27(20(30)26-25)14-8-15(21)19(16(22)9-14)28-10-11(2-5-18(28)29)6-12-3-4-13(23)7-17(12)24/h3-4,7-9,11H,2,5-6,10,25H2,1H3,(H,26,30) |
| InChIKey | RMNOCXZHEOGMPJ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.31 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|