C27H32F2N2O4 — CID 23022234
ethyl 4-[[4-[5-[(2,4-difluorophenyl)methyl]-2-oxopiperidin-1-yl]-3,5-dimethylbenzoyl]amino]butanoate (PubChem CID 23022234) has the molecular formula C27H32F2N2O4 and a molecular weight of 486.56 g/mol. Its IUPAC name is ethyl 4-[[4-[5-[(2,4-difluorophenyl)methyl]-2-oxopiperidin-1-yl]-3,5-dimethylbenzoyl]amino]butanoate.
| Compound Name | ethyl 4-[[4-[5-[(2,4-difluorophenyl)methyl]-2-oxopiperidin-1-yl]-3,5-dimethylbenzoyl]amino]butanoate |
|---|---|
| PubChem CID | 23022234 |
| Molecular Formula | C27H32F2N2O4 |
| Molecular Weight | 486.56 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | ethyl 4-[[4-[5-[(2,4-difluorophenyl)methyl]-2-oxopiperidin-1-yl]-3,5-dimethylbenzoyl]amino]butanoate |
| SMILES | CCOC(=O)CCCNC(=O)c1cc(C)c(N2CC(Cc3ccc(F)cc3F)CCC2=O)c(C)c1 |
| InChI | InChI=1S/C27H32F2N2O4/c1-4-35-25(33)6-5-11-30-27(34)21-12-17(2)26(18(3)13-21)31-16-19(7-10-24(31)32)14-20-8-9-22(28)15-23(20)29/h8-9,12-13,15,19H,4-7,10-11,14,16H2,1-3H3,(H,30,34) |
| InChIKey | QEKNRCDANQWRGD-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.56 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|