C12H15F2N3O3S — CID 102886410
(3,5-difluoro-4-hydrazinylphenyl)-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methanone (PubChem CID 102886410) has the molecular formula C12H15F2N3O3S and a molecular weight of 319.33 g/mol. Its IUPAC name is (3,5-difluoro-4-hydrazinylphenyl)-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methanone.
| Compound Name | (3,5-difluoro-4-hydrazinylphenyl)-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methanone |
|---|---|
| PubChem CID | 102886410 |
| Molecular Formula | C12H15F2N3O3S |
| Molecular Weight | 319.33 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | (3,5-difluoro-4-hydrazinylphenyl)-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)methanone |
| SMILES | CC1CS(=O)(=O)CCN1C(=O)c1cc(F)c(NN)c(F)c1 |
| InChI | InChI=1S/C12H15F2N3O3S/c1-7-6-21(19,20)3-2-17(7)12(18)8-4-9(13)11(16-15)10(14)5-8/h4-5,7,16H,2-3,6,15H2,1H3 |
| InChIKey | ALWZEKKQSPREOG-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.33 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|