C14H20ClN3O — CID 102889325
4-[4-(1-aminoethyl)-2-chlorophenyl]-1-methyl-1,4-diazepan-2-one (PubChem CID 102889325) has the molecular formula C14H20ClN3O and a molecular weight of 281.79 g/mol. Its IUPAC name is 4-[4-(1-aminoethyl)-2-chlorophenyl]-1-methyl-1,4-diazepan-2-one.
| Compound Name | 4-[4-(1-aminoethyl)-2-chlorophenyl]-1-methyl-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 102889325 |
| Molecular Formula | C14H20ClN3O |
| Molecular Weight | 281.79 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 4-[4-(1-aminoethyl)-2-chlorophenyl]-1-methyl-1,4-diazepan-2-one |
| SMILES | CC(N)c1ccc(N2CCCN(C)C(=O)C2)c(Cl)c1 |
| InChI | InChI=1S/C14H20ClN3O/c1-10(16)11-4-5-13(12(15)8-11)18-7-3-6-17(2)14(19)9-18/h4-5,8,10H,3,6-7,9,16H2,1-2H3 |
| InChIKey | ODNUVHJEKTYFBT-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.79 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |