C15H21NO2 — CID 102893676
2-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-yl)-1-(2,5-dimethylfuran-3-yl)ethanone (PubChem CID 102893676) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is 2-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-yl)-1-(2,5-dimethylfuran-3-yl)ethanone.
| Compound Name | 2-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-yl)-1-(2,5-dimethylfuran-3-yl)ethanone |
|---|---|
| PubChem CID | 102893676 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | 2-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-yl)-1-(2,5-dimethylfuran-3-yl)ethanone |
| SMILES | Cc1cc(C(=O)CC2NCC3CCCC32)c(C)o1 |
| InChI | InChI=1S/C15H21NO2/c1-9-6-13(10(2)18-9)15(17)7-14-12-5-3-4-11(12)8-16-14/h6,11-12,14,16H,3-5,7-8H2,1-2H3 |
| InChIKey | JFWVYKYEDJQTCK-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |