C17H25N3 — CID 102894569
1-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-ylmethyl)-4-methyl-2,3-dihydroquinoxaline (PubChem CID 102894569) has the molecular formula C17H25N3 and a molecular weight of 271.41 g/mol. Its IUPAC name is 1-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-ylmethyl)-4-methyl-2,3-dihydroquinoxaline.
| Compound Name | 1-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-ylmethyl)-4-methyl-2,3-dihydroquinoxaline |
|---|---|
| PubChem CID | 102894569 |
| Molecular Formula | C17H25N3 |
| Molecular Weight | 271.41 g/mol |
| Exact Mass | 271.20 |
| IUPAC Name | 1-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-ylmethyl)-4-methyl-2,3-dihydroquinoxaline |
| SMILES | CN1CCN(CC2NCC3CCCC32)c2ccccc21 |
| InChI | InChI=1S/C17H25N3/c1-19-9-10-20(17-8-3-2-7-16(17)19)12-15-14-6-4-5-13(14)11-18-15/h2-3,7-8,13-15,18H,4-6,9-12H2,1H3 |
| InChIKey | DVTICPIAAYGQPA-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.41 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |