C10H18F2N2 — CID 102894679
N-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-ylmethyl)-2,2-difluoroethanamine (PubChem CID 102894679) has the molecular formula C10H18F2N2 and a molecular weight of 204.26 g/mol. Its IUPAC name is N-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-ylmethyl)-2,2-difluoroethanamine.
| Compound Name | N-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-ylmethyl)-2,2-difluoroethanamine |
|---|---|
| PubChem CID | 102894679 |
| Molecular Formula | C10H18F2N2 |
| Molecular Weight | 204.26 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | N-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-ylmethyl)-2,2-difluoroethanamine |
| SMILES | FC(F)CNCC1NCC2CCCC21 |
| InChI | InChI=1S/C10H18F2N2/c11-10(12)6-13-5-9-8-3-1-2-7(8)4-14-9/h7-10,13-14H,1-6H2 |
| InChIKey | UCQGPWGQEGBDMK-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.26 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |