C8H12F3N — CID 67749590
(2S,3aS,6aS)-2-(trifluoromethyl)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrole (PubChem CID 67749590) has the molecular formula C8H12F3N and a molecular weight of 179.18 g/mol. Its IUPAC name is (2S,3aS,6aS)-2-(trifluoromethyl)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrole.
| Compound Name | (2S,3aS,6aS)-2-(trifluoromethyl)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrole |
|---|---|
| PubChem CID | 67749590 |
| Molecular Formula | C8H12F3N |
| Molecular Weight | 179.18 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | (2S,3aS,6aS)-2-(trifluoromethyl)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrole |
| SMILES | FC(F)(F)[C@@H]1C[C@@H]2CCC[C@@H]2N1 |
| InChI | InChI=1S/C8H12F3N/c9-8(10,11)7-4-5-2-1-3-6(5)12-7/h5-7,12H,1-4H2/t5-,6-,7-/m0/s1 |
| InChIKey | MCGNKFKKMKGODY-ACZMJKKPSA-N |
| XLogP | 2.08 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.18 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |