C14H18N2O3S — CID 102895715
2-(2-amino-2-thiophen-2-ylacetyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylic acid (PubChem CID 102895715) has the molecular formula C14H18N2O3S and a molecular weight of 294.38 g/mol. Its IUPAC name is 2-(2-amino-2-thiophen-2-ylacetyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylic acid.
| Compound Name | 2-(2-amino-2-thiophen-2-ylacetyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 102895715 |
| Molecular Formula | C14H18N2O3S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 2-(2-amino-2-thiophen-2-ylacetyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylic acid |
| SMILES | NC(C(=O)N1CC2CCCC2C1C(=O)O)c1cccs1 |
| InChI | InChI=1S/C14H18N2O3S/c15-11(10-5-2-6-20-10)13(17)16-7-8-3-1-4-9(8)12(16)14(18)19/h2,5-6,8-9,11-12H,1,3-4,7,15H2,(H,18,19) |
| InChIKey | IUJYTIPOEGZBKQ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |