C18H24ClNO — CID 102902619
3-(3-chlorophenyl)-3-(1-oxaspiro[4.4]nonan-2-ylmethyl)azetidine (PubChem CID 102902619) has the molecular formula C18H24ClNO and a molecular weight of 305.85 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-3-(1-oxaspiro[4.4]nonan-2-ylmethyl)azetidine.
| Compound Name | 3-(3-chlorophenyl)-3-(1-oxaspiro[4.4]nonan-2-ylmethyl)azetidine |
|---|---|
| PubChem CID | 102902619 |
| Molecular Formula | C18H24ClNO |
| Molecular Weight | 305.85 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | 3-(3-chlorophenyl)-3-(1-oxaspiro[4.4]nonan-2-ylmethyl)azetidine |
| SMILES | Clc1cccc(C2(CC3CCC4(CCCC4)O3)CNC2)c1 |
| InChI | InChI=1S/C18H24ClNO/c19-15-5-3-4-14(10-15)17(12-20-13-17)11-16-6-9-18(21-16)7-1-2-8-18/h3-5,10,16,20H,1-2,6-9,11-13H2 |
| InChIKey | SNSBMHXMIYVDKE-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.85 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |