C16H22ClNO — CID 116525360
3-(4-chlorophenyl)-3-[(5,5-dimethyloxolan-2-yl)methyl]azetidine (PubChem CID 116525360) has the molecular formula C16H22ClNO and a molecular weight of 279.81 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-3-[(5,5-dimethyloxolan-2-yl)methyl]azetidine.
| Compound Name | 3-(4-chlorophenyl)-3-[(5,5-dimethyloxolan-2-yl)methyl]azetidine |
|---|---|
| PubChem CID | 116525360 |
| Molecular Formula | C16H22ClNO |
| Molecular Weight | 279.81 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | 3-(4-chlorophenyl)-3-[(5,5-dimethyloxolan-2-yl)methyl]azetidine |
| SMILES | CC1(C)CCC(CC2(c3ccc(Cl)cc3)CNC2)O1 |
| InChI | InChI=1S/C16H22ClNO/c1-15(2)8-7-14(19-15)9-16(10-18-11-16)12-3-5-13(17)6-4-12/h3-6,14,18H,7-11H2,1-2H3 |
| InChIKey | VOVKZBWGAWFYKM-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.81 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |