C18H19NO — CID 102911939
[1-(3-phenylpropyl)indol-7-yl]methanol (PubChem CID 102911939) has the molecular formula C18H19NO and a molecular weight of 265.36 g/mol. Its IUPAC name is [1-(3-phenylpropyl)indol-7-yl]methanol.
| Compound Name | [1-(3-phenylpropyl)indol-7-yl]methanol |
|---|---|
| PubChem CID | 102911939 |
| Molecular Formula | C18H19NO |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | [1-(3-phenylpropyl)indol-7-yl]methanol |
| SMILES | OCc1cccc2ccn(CCCc3ccccc3)c12 |
| InChI | InChI=1S/C18H19NO/c20-14-17-10-4-9-16-11-13-19(18(16)17)12-5-8-15-6-2-1-3-7-15/h1-4,6-7,9-11,13,20H,5,8,12,14H2 |
| InChIKey | WRXQGINUCBUMCO-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |