C17H14N2OS — CID 102912903
[1-(1,3-benzothiazol-2-ylmethyl)indol-5-yl]methanol (PubChem CID 102912903) has the molecular formula C17H14N2OS and a molecular weight of 294.38 g/mol. Its IUPAC name is [1-(1,3-benzothiazol-2-ylmethyl)indol-5-yl]methanol.
| Compound Name | [1-(1,3-benzothiazol-2-ylmethyl)indol-5-yl]methanol |
|---|---|
| PubChem CID | 102912903 |
| Molecular Formula | C17H14N2OS |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | [1-(1,3-benzothiazol-2-ylmethyl)indol-5-yl]methanol |
| SMILES | OCc1ccc2c(ccn2Cc2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C17H14N2OS/c20-11-12-5-6-15-13(9-12)7-8-19(15)10-17-18-14-3-1-2-4-16(14)21-17/h1-9,20H,10-11H2 |
| InChIKey | JJNMUOMUESTIMY-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |