C16H11FN2S — CID 104632094
2-[(4-fluoroindol-1-yl)methyl]-1,3-benzothiazole (PubChem CID 104632094) has the molecular formula C16H11FN2S and a molecular weight of 282.34 g/mol. Its IUPAC name is 2-[(4-fluoroindol-1-yl)methyl]-1,3-benzothiazole.
| Compound Name | 2-[(4-fluoroindol-1-yl)methyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 104632094 |
| Molecular Formula | C16H11FN2S |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 2-[(4-fluoroindol-1-yl)methyl]-1,3-benzothiazole |
| SMILES | Fc1cccc2c1ccn2Cc1nc2ccccc2s1 |
| InChI | InChI=1S/C16H11FN2S/c17-12-4-3-6-14-11(12)8-9-19(14)10-16-18-13-5-1-2-7-15(13)20-16/h1-9H,10H2 |
| InChIKey | GOVZTXYLKRGCBP-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |