C18H16IN5S — CID 130246570
2-[(2-iodo-4-pyrrolidin-1-ylpyrrolo[2,3-d]pyrimidin-7-yl)methyl]-1,3-benzothiazole (PubChem CID 130246570) has the molecular formula C18H16IN5S and a molecular weight of 461.33 g/mol. Its IUPAC name is 2-[(2-iodo-4-pyrrolidin-1-ylpyrrolo[2,3-d]pyrimidin-7-yl)methyl]-1,3-benzothiazole.
| Compound Name | 2-[(2-iodo-4-pyrrolidin-1-ylpyrrolo[2,3-d]pyrimidin-7-yl)methyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 130246570 |
| Molecular Formula | C18H16IN5S |
| Molecular Weight | 461.33 g/mol |
| Exact Mass | 461.02 |
| IUPAC Name | 2-[(2-iodo-4-pyrrolidin-1-ylpyrrolo[2,3-d]pyrimidin-7-yl)methyl]-1,3-benzothiazole |
| SMILES | Ic1nc(N2CCCC2)c2ccn(Cc3nc4ccccc4s3)c2n1 |
| InChI | InChI=1S/C18H16IN5S/c19-18-21-16(23-8-3-4-9-23)12-7-10-24(17(12)22-18)11-15-20-13-5-1-2-6-14(13)25-15/h1-2,5-7,10H,3-4,8-9,11H2 |
| InChIKey | DICWYYBHDDITHL-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.33 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|