C21H18FN3O — CID 10291350
(E)-N-[(1S)-1-[3-(6-fluoro-3-pyridinyl)phenyl]ethyl]-3-pyridin-4-ylprop-2-enamide (PubChem CID 10291350) has the molecular formula C21H18FN3O and a molecular weight of 347.39 g/mol. Its IUPAC name is (E)-N-[(1S)-1-[3-(6-fluoro-3-pyridinyl)phenyl]ethyl]-3-pyridin-4-ylprop-2-enamide.
| Compound Name | (E)-N-[(1S)-1-[3-(6-fluoro-3-pyridinyl)phenyl]ethyl]-3-pyridin-4-ylprop-2-enamide |
|---|---|
| PubChem CID | 10291350 |
| Molecular Formula | C21H18FN3O |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | (E)-N-[(1S)-1-[3-(6-fluoro-3-pyridinyl)phenyl]ethyl]-3-pyridin-4-ylprop-2-enamide |
| SMILES | C[C@H](NC(=O)/C=C/c1ccncc1)c1cccc(-c2ccc(F)nc2)c1 |
| InChI | InChI=1S/C21H18FN3O/c1-15(25-21(26)8-5-16-9-11-23-12-10-16)17-3-2-4-18(13-17)19-6-7-20(22)24-14-19/h2-15H,1H3,(H,25,26)/b8-5+/t15-/m0/s1 |
| InChIKey | SCNOYCZUTIUCQT-PXTSUWAFSA-N |
| XLogP | 4.17 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|