C22H17ClF2N2O — CID 22605626
(E)-N-[1-[3-(6-chloro-3-pyridinyl)phenyl]ethyl]-3-(3,4-difluorophenyl)prop-2-enamide (PubChem CID 22605626) has the molecular formula C22H17ClF2N2O and a molecular weight of 398.84 g/mol. Its IUPAC name is (E)-N-[1-[3-(6-chloro-3-pyridinyl)phenyl]ethyl]-3-(3,4-difluorophenyl)prop-2-enamide.
| Compound Name | (E)-N-[1-[3-(6-chloro-3-pyridinyl)phenyl]ethyl]-3-(3,4-difluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 22605626 |
| Molecular Formula | C22H17ClF2N2O |
| Molecular Weight | 398.84 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | (E)-N-[1-[3-(6-chloro-3-pyridinyl)phenyl]ethyl]-3-(3,4-difluorophenyl)prop-2-enamide |
| SMILES | CC(NC(=O)/C=C/c1ccc(F)c(F)c1)c1cccc(-c2ccc(Cl)nc2)c1 |
| InChI | InChI=1S/C22H17ClF2N2O/c1-14(27-22(28)10-6-15-5-8-19(24)20(25)11-15)16-3-2-4-17(12-16)18-7-9-21(23)26-13-18/h2-14H,1H3,(H,27,28)/b10-6+ |
| InChIKey | SXNNUBRLPYFZQH-UXBLZVDNSA-N |
| XLogP | 5.57 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.84 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|