C12H13F3N2 — CID 102913583
[1-(3,3,3-trifluoropropyl)indol-7-yl]methanamine (PubChem CID 102913583) has the molecular formula C12H13F3N2 and a molecular weight of 242.24 g/mol. Its IUPAC name is [1-(3,3,3-trifluoropropyl)indol-7-yl]methanamine.
| Compound Name | [1-(3,3,3-trifluoropropyl)indol-7-yl]methanamine |
|---|---|
| PubChem CID | 102913583 |
| Molecular Formula | C12H13F3N2 |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | [1-(3,3,3-trifluoropropyl)indol-7-yl]methanamine |
| SMILES | NCc1cccc2ccn(CCC(F)(F)F)c12 |
| InChI | InChI=1S/C12H13F3N2/c13-12(14,15)5-7-17-6-4-9-2-1-3-10(8-16)11(9)17/h1-4,6H,5,7-8,16H2 |
| InChIKey | VQDJIUFXWYKTDL-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |