C14H20N2S — CID 113474456
[1-(3-ethylsulfanylpropyl)indol-7-yl]methanamine (PubChem CID 113474456) has the molecular formula C14H20N2S and a molecular weight of 248.39 g/mol. Its IUPAC name is [1-(3-ethylsulfanylpropyl)indol-7-yl]methanamine.
| Compound Name | [1-(3-ethylsulfanylpropyl)indol-7-yl]methanamine |
|---|---|
| PubChem CID | 113474456 |
| Molecular Formula | C14H20N2S |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | [1-(3-ethylsulfanylpropyl)indol-7-yl]methanamine |
| SMILES | CCSCCCn1ccc2cccc(CN)c21 |
| InChI | InChI=1S/C14H20N2S/c1-2-17-10-4-8-16-9-7-12-5-3-6-13(11-15)14(12)16/h3,5-7,9H,2,4,8,10-11,15H2,1H3 |
| InChIKey | PORNEOAOHOWYPM-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|