C14H17F3N2O — CID 102917151
2-[1-[2-(2,2,2-trifluoroethoxy)ethyl]indol-7-yl]ethanamine (PubChem CID 102917151) has the molecular formula C14H17F3N2O and a molecular weight of 286.30 g/mol. Its IUPAC name is 2-[1-[2-(2,2,2-trifluoroethoxy)ethyl]indol-7-yl]ethanamine.
| Compound Name | 2-[1-[2-(2,2,2-trifluoroethoxy)ethyl]indol-7-yl]ethanamine |
|---|---|
| PubChem CID | 102917151 |
| Molecular Formula | C14H17F3N2O |
| Molecular Weight | 286.30 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 2-[1-[2-(2,2,2-trifluoroethoxy)ethyl]indol-7-yl]ethanamine |
| SMILES | NCCc1cccc2ccn(CCOCC(F)(F)F)c12 |
| InChI | InChI=1S/C14H17F3N2O/c15-14(16,17)10-20-9-8-19-7-5-12-3-1-2-11(4-6-18)13(12)19/h1-3,5,7H,4,6,8-10,18H2 |
| InChIKey | MVHANROBWWTDAE-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 40.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.30 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|