C17H23N3 — CID 102917116
5-[7-(2-aminoethyl)indol-1-yl]-2,2-dimethylpentanenitrile (PubChem CID 102917116) has the molecular formula C17H23N3 and a molecular weight of 269.39 g/mol. Its IUPAC name is 5-[7-(2-aminoethyl)indol-1-yl]-2,2-dimethylpentanenitrile.
| Compound Name | 5-[7-(2-aminoethyl)indol-1-yl]-2,2-dimethylpentanenitrile |
|---|---|
| PubChem CID | 102917116 |
| Molecular Formula | C17H23N3 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.19 |
| IUPAC Name | 5-[7-(2-aminoethyl)indol-1-yl]-2,2-dimethylpentanenitrile |
| SMILES | CC(C)(C#N)CCCn1ccc2cccc(CCN)c21 |
| InChI | InChI=1S/C17H23N3/c1-17(2,13-19)9-4-11-20-12-8-15-6-3-5-14(7-10-18)16(15)20/h3,5-6,8,12H,4,7,9-11,18H2,1-2H3 |
| InChIKey | KKZMMMUGVOIKDR-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 54.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |