C13H18N6S — CID 102926985
6-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-N,2-N,4-N-trimethyl-1,3,5-triazine-2,4-diamine (PubChem CID 102926985) has the molecular formula C13H18N6S and a molecular weight of 290.40 g/mol. Its IUPAC name is 6-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-N,2-N,4-N-trimethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-N,2-N,4-N-trimethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 102926985 |
| Molecular Formula | C13H18N6S |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 6-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-N,2-N,4-N-trimethyl-1,3,5-triazine-2,4-diamine |
| SMILES | CNc1nc(Sc2cc(C)cc(C)n2)nc(N(C)C)n1 |
| InChI | InChI=1S/C13H18N6S/c1-8-6-9(2)15-10(7-8)20-13-17-11(14-3)16-12(18-13)19(4)5/h6-7H,1-5H3,(H,14,16,17,18) |
| InChIKey | GJMFSFMOPACWAV-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 66.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |