C9H14N8S — CID 104604969
2-N,2-N,4-N-trimethyl-6-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-1,3,5-triazine-2,4-diamine (PubChem CID 104604969) has the molecular formula C9H14N8S and a molecular weight of 266.33 g/mol. Its IUPAC name is 2-N,2-N,4-N-trimethyl-6-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,2-N,4-N-trimethyl-6-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 104604969 |
| Molecular Formula | C9H14N8S |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 2-N,2-N,4-N-trimethyl-6-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-1,3,5-triazine-2,4-diamine |
| SMILES | CNc1nc(Sc2ncnn2C)nc(N(C)C)n1 |
| InChI | InChI=1S/C9H14N8S/c1-10-6-13-7(16(2)3)15-8(14-6)18-9-11-5-12-17(9)4/h5H,1-4H3,(H,10,13,14,15) |
| InChIKey | KJYUCLHRHYTYFM-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 84.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |