C9H13BrN2O4 — CID 102927169
5-bromo-4-hydroxy-2-[2-(2-methoxyethoxy)ethyl]-1H-pyrimidin-6-one (PubChem CID 102927169) has the molecular formula C9H13BrN2O4 and a molecular weight of 293.12 g/mol. Its IUPAC name is 5-bromo-4-hydroxy-2-[2-(2-methoxyethoxy)ethyl]-1H-pyrimidin-6-one.
| Compound Name | 5-bromo-4-hydroxy-2-[2-(2-methoxyethoxy)ethyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 102927169 |
| Molecular Formula | C9H13BrN2O4 |
| Molecular Weight | 293.12 g/mol |
| Exact Mass | 292.01 |
| IUPAC Name | 5-bromo-4-hydroxy-2-[2-(2-methoxyethoxy)ethyl]-1H-pyrimidin-6-one |
| SMILES | COCCOCCc1nc(O)c(Br)c(=O)[nH]1 |
| InChI | InChI=1S/C9H13BrN2O4/c1-15-4-5-16-3-2-6-11-8(13)7(10)9(14)12-6/h2-5H2,1H3,(H2,11,12,13,14) |
| InChIKey | WHDJONZCAXRJTJ-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 84.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.12 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|