C11H22N2O3 — CID 102929992
[1-(3,4-dihydro-2H-pyran-6-yl)-3-(2-methoxyethoxy)propyl]hydrazine (PubChem CID 102929992) has the molecular formula C11H22N2O3 and a molecular weight of 230.31 g/mol. Its IUPAC name is [1-(3,4-dihydro-2H-pyran-6-yl)-3-(2-methoxyethoxy)propyl]hydrazine.
| Compound Name | [1-(3,4-dihydro-2H-pyran-6-yl)-3-(2-methoxyethoxy)propyl]hydrazine |
|---|---|
| PubChem CID | 102929992 |
| Molecular Formula | C11H22N2O3 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.16 |
| IUPAC Name | [1-(3,4-dihydro-2H-pyran-6-yl)-3-(2-methoxyethoxy)propyl]hydrazine |
| SMILES | COCCOCCC(NN)C1=CCCCO1 |
| InChI | InChI=1S/C11H22N2O3/c1-14-8-9-15-7-5-10(13-12)11-4-2-3-6-16-11/h4,10,13H,2-3,5-9,12H2,1H3 |
| InChIKey | GIWSCZBKQFCNJJ-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|