C14H19ClN2O3 — CID 102935941
3-chloro-4-[[2-(hydroxymethyl)-6-methylmorpholin-4-yl]methyl]benzamide (PubChem CID 102935941) has the molecular formula C14H19ClN2O3 and a molecular weight of 298.77 g/mol. Its IUPAC name is 3-chloro-4-[[2-(hydroxymethyl)-6-methylmorpholin-4-yl]methyl]benzamide.
| Compound Name | 3-chloro-4-[[2-(hydroxymethyl)-6-methylmorpholin-4-yl]methyl]benzamide |
|---|---|
| PubChem CID | 102935941 |
| Molecular Formula | C14H19ClN2O3 |
| Molecular Weight | 298.77 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 3-chloro-4-[[2-(hydroxymethyl)-6-methylmorpholin-4-yl]methyl]benzamide |
| SMILES | CC1CN(Cc2ccc(C(N)=O)cc2Cl)CC(CO)O1 |
| InChI | InChI=1S/C14H19ClN2O3/c1-9-5-17(7-12(8-18)20-9)6-11-3-2-10(14(16)19)4-13(11)15/h2-4,9,12,18H,5-8H2,1H3,(H2,16,19) |
| InChIKey | FTNMQPDKFYSSFR-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.77 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |