C13H16Cl3NO — CID 102936602
2-(chloromethyl)-4-[(2,4-dichlorophenyl)methyl]-6-methylmorpholine (PubChem CID 102936602) has the molecular formula C13H16Cl3NO and a molecular weight of 308.64 g/mol. Its IUPAC name is 2-(chloromethyl)-4-[(2,4-dichlorophenyl)methyl]-6-methylmorpholine.
| Compound Name | 2-(chloromethyl)-4-[(2,4-dichlorophenyl)methyl]-6-methylmorpholine |
|---|---|
| PubChem CID | 102936602 |
| Molecular Formula | C13H16Cl3NO |
| Molecular Weight | 308.64 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | 2-(chloromethyl)-4-[(2,4-dichlorophenyl)methyl]-6-methylmorpholine |
| SMILES | CC1CN(Cc2ccc(Cl)cc2Cl)CC(CCl)O1 |
| InChI | InChI=1S/C13H16Cl3NO/c1-9-6-17(8-12(5-14)18-9)7-10-2-3-11(15)4-13(10)16/h2-4,9,12H,5-8H2,1H3 |
| InChIKey | AUUPHIGKDQHPJS-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.64 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|