C11H12BrCl2N — CID 130531229
3-(bromomethyl)-1-[(2,4-dichlorophenyl)methyl]azetidine (PubChem CID 130531229) has the molecular formula C11H12BrCl2N and a molecular weight of 309.03 g/mol. Its IUPAC name is 3-(bromomethyl)-1-[(2,4-dichlorophenyl)methyl]azetidine.
| Compound Name | 3-(bromomethyl)-1-[(2,4-dichlorophenyl)methyl]azetidine |
|---|---|
| PubChem CID | 130531229 |
| Molecular Formula | C11H12BrCl2N |
| Molecular Weight | 309.03 g/mol |
| Exact Mass | 306.95 |
| IUPAC Name | 3-(bromomethyl)-1-[(2,4-dichlorophenyl)methyl]azetidine |
| SMILES | Clc1ccc(CN2CC(CBr)C2)c(Cl)c1 |
| InChI | InChI=1S/C11H12BrCl2N/c12-4-8-5-15(6-8)7-9-1-2-10(13)3-11(9)14/h1-3,8H,4-7H2 |
| InChIKey | XLHUTECZSINKDD-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.03 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|