C11H12Cl2N2O — CID 175002394
1-[(2,4-dichlorophenyl)methyl]imidazolidine-4-carbaldehyde (PubChem CID 175002394) has the molecular formula C11H12Cl2N2O and a molecular weight of 259.14 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenyl)methyl]imidazolidine-4-carbaldehyde.
| Compound Name | 1-[(2,4-dichlorophenyl)methyl]imidazolidine-4-carbaldehyde |
|---|---|
| PubChem CID | 175002394 |
| Molecular Formula | C11H12Cl2N2O |
| Molecular Weight | 259.14 g/mol |
| Exact Mass | 258.03 |
| IUPAC Name | 1-[(2,4-dichlorophenyl)methyl]imidazolidine-4-carbaldehyde |
| SMILES | O=CC1CN(Cc2ccc(Cl)cc2Cl)CN1 |
| InChI | InChI=1S/C11H12Cl2N2O/c12-9-2-1-8(11(13)3-9)4-15-5-10(6-16)14-7-15/h1-3,6,10,14H,4-5,7H2 |
| InChIKey | CASGKBUFSOUOJJ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.14 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|