C15H19ClN2O2 — CID 102669720
3-chloro-4-[(4-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)methyl]benzamide (PubChem CID 102669720) has the molecular formula C15H19ClN2O2 and a molecular weight of 294.78 g/mol. Its IUPAC name is 3-chloro-4-[(4-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)methyl]benzamide.
| Compound Name | 3-chloro-4-[(4-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 102669720 |
| Molecular Formula | C15H19ClN2O2 |
| Molecular Weight | 294.78 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 3-chloro-4-[(4-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)methyl]benzamide |
| SMILES | NC(=O)c1ccc(CN2CC3CCC(O)C3C2)c(Cl)c1 |
| InChI | InChI=1S/C15H19ClN2O2/c16-13-5-9(15(17)20)1-2-11(13)7-18-6-10-3-4-14(19)12(10)8-18/h1-2,5,10,12,14,19H,3-4,6-8H2,(H2,17,20) |
| InChIKey | FPIYLUFFBKOJAZ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.78 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |