C15H18ClN3O2 — CID 103195913
3-chloro-4-[(5-oxo-2,3,4,4a,7,7a-hexahydro-1H-pyrrolo[3,4-b]pyridin-6-yl)methyl]benzamide (PubChem CID 103195913) has the molecular formula C15H18ClN3O2 and a molecular weight of 307.78 g/mol. Its IUPAC name is 3-chloro-4-[(5-oxo-2,3,4,4a,7,7a-hexahydro-1H-pyrrolo[3,4-b]pyridin-6-yl)methyl]benzamide.
| Compound Name | 3-chloro-4-[(5-oxo-2,3,4,4a,7,7a-hexahydro-1H-pyrrolo[3,4-b]pyridin-6-yl)methyl]benzamide |
|---|---|
| PubChem CID | 103195913 |
| Molecular Formula | C15H18ClN3O2 |
| Molecular Weight | 307.78 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 3-chloro-4-[(5-oxo-2,3,4,4a,7,7a-hexahydro-1H-pyrrolo[3,4-b]pyridin-6-yl)methyl]benzamide |
| SMILES | NC(=O)c1ccc(CN2CC3NCCCC3C2=O)c(Cl)c1 |
| InChI | InChI=1S/C15H18ClN3O2/c16-12-6-9(14(17)20)3-4-10(12)7-19-8-13-11(15(19)21)2-1-5-18-13/h3-4,6,11,13,18H,1-2,5,7-8H2,(H2,17,20) |
| InChIKey | QYDOJQJDRYBNLO-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.78 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |