C14H16Cl2N2O — CID 103195679
6-[(2,5-dichlorophenyl)methyl]-2,3,4,4a,7,7a-hexahydro-1H-pyrrolo[3,4-b]pyridin-5-one (PubChem CID 103195679) has the molecular formula C14H16Cl2N2O and a molecular weight of 299.20 g/mol. Its IUPAC name is 6-[(2,5-dichlorophenyl)methyl]-2,3,4,4a,7,7a-hexahydro-1H-pyrrolo[3,4-b]pyridin-5-one.
| Compound Name | 6-[(2,5-dichlorophenyl)methyl]-2,3,4,4a,7,7a-hexahydro-1H-pyrrolo[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 103195679 |
| Molecular Formula | C14H16Cl2N2O |
| Molecular Weight | 299.20 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 6-[(2,5-dichlorophenyl)methyl]-2,3,4,4a,7,7a-hexahydro-1H-pyrrolo[3,4-b]pyridin-5-one |
| SMILES | O=C1C2CCCNC2CN1Cc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H16Cl2N2O/c15-10-3-4-12(16)9(6-10)7-18-8-13-11(14(18)19)2-1-5-17-13/h3-4,6,11,13,17H,1-2,5,7-8H2 |
| InChIKey | NIVBEPLLGMQOJV-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.20 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |