C12H19BrN4O — CID 102937271
4-[2-(bromomethyl)-6-methylmorpholin-4-yl]-N,N-dimethylpyrimidin-2-amine (PubChem CID 102937271) has the molecular formula C12H19BrN4O and a molecular weight of 315.22 g/mol. Its IUPAC name is 4-[2-(bromomethyl)-6-methylmorpholin-4-yl]-N,N-dimethylpyrimidin-2-amine.
| Compound Name | 4-[2-(bromomethyl)-6-methylmorpholin-4-yl]-N,N-dimethylpyrimidin-2-amine |
|---|---|
| PubChem CID | 102937271 |
| Molecular Formula | C12H19BrN4O |
| Molecular Weight | 315.22 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 4-[2-(bromomethyl)-6-methylmorpholin-4-yl]-N,N-dimethylpyrimidin-2-amine |
| SMILES | CC1CN(c2ccnc(N(C)C)n2)CC(CBr)O1 |
| InChI | InChI=1S/C12H19BrN4O/c1-9-7-17(8-10(6-13)18-9)11-4-5-14-12(15-11)16(2)3/h4-5,9-10H,6-8H2,1-3H3 |
| InChIKey | CIPKLMIAGVGYGV-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.22 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|