C11H20BrNO4S — CID 102937987
1-[2-(bromomethyl)-6-methylmorpholin-4-yl]-2-methyl-2-methylsulfonylpropan-1-one (PubChem CID 102937987) has the molecular formula C11H20BrNO4S and a molecular weight of 342.26 g/mol. Its IUPAC name is 1-[2-(bromomethyl)-6-methylmorpholin-4-yl]-2-methyl-2-methylsulfonylpropan-1-one.
| Compound Name | 1-[2-(bromomethyl)-6-methylmorpholin-4-yl]-2-methyl-2-methylsulfonylpropan-1-one |
|---|---|
| PubChem CID | 102937987 |
| Molecular Formula | C11H20BrNO4S |
| Molecular Weight | 342.26 g/mol |
| Exact Mass | 341.03 |
| IUPAC Name | 1-[2-(bromomethyl)-6-methylmorpholin-4-yl]-2-methyl-2-methylsulfonylpropan-1-one |
| SMILES | CC1CN(C(=O)C(C)(C)S(C)(=O)=O)CC(CBr)O1 |
| InChI | InChI=1S/C11H20BrNO4S/c1-8-6-13(7-9(5-12)17-8)10(14)11(2,3)18(4,15)16/h8-9H,5-7H2,1-4H3 |
| InChIKey | HPJCNDZDZMZSBP-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.26 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|