C10H13NO4 — CID 102945677
(2R,5S)-5-(but-2-ynylcarbamoyl)oxolane-2-carboxylic acid (PubChem CID 102945677) has the molecular formula C10H13NO4 and a molecular weight of 211.22 g/mol. Its IUPAC name is (2R,5S)-5-(but-2-ynylcarbamoyl)oxolane-2-carboxylic acid.
| Compound Name | (2R,5S)-5-(but-2-ynylcarbamoyl)oxolane-2-carboxylic acid |
|---|---|
| PubChem CID | 102945677 |
| Molecular Formula | C10H13NO4 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | (2R,5S)-5-(but-2-ynylcarbamoyl)oxolane-2-carboxylic acid |
| SMILES | CC#CCNC(=O)[C@@H]1CC[C@H](C(=O)O)O1 |
| InChI | InChI=1S/C10H13NO4/c1-2-3-6-11-9(12)7-4-5-8(15-7)10(13)14/h7-8H,4-6H2,1H3,(H,11,12)(H,13,14)/t7-,8+/m0/s1 |
| InChIKey | XKUKOZNGRBVVHX-JGVFFNPUSA-N |
| XLogP | -0.24 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|