C11H15NO3 — CID 103551165
3-(but-2-ynylcarbamoyl)cyclopentane-1-carboxylic acid (PubChem CID 103551165) has the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. Its IUPAC name is 3-(but-2-ynylcarbamoyl)cyclopentane-1-carboxylic acid.
| Compound Name | 3-(but-2-ynylcarbamoyl)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 103551165 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | 3-(but-2-ynylcarbamoyl)cyclopentane-1-carboxylic acid |
| SMILES | CC#CCNC(=O)C1CCC(C(=O)O)C1 |
| InChI | InChI=1S/C11H15NO3/c1-2-3-6-12-10(13)8-4-5-9(7-8)11(14)15/h8-9H,4-7H2,1H3,(H,12,13)(H,14,15) |
| InChIKey | HMPCUFGFNZPUOR-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|