C12H16N2O4S — CID 102946161
5-amino-N-but-3-yn-2-yl-2,4-dimethoxybenzenesulfonamide (PubChem CID 102946161) has the molecular formula C12H16N2O4S and a molecular weight of 284.34 g/mol. Its IUPAC name is 5-amino-N-but-3-yn-2-yl-2,4-dimethoxybenzenesulfonamide.
| Compound Name | 5-amino-N-but-3-yn-2-yl-2,4-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 102946161 |
| Molecular Formula | C12H16N2O4S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 5-amino-N-but-3-yn-2-yl-2,4-dimethoxybenzenesulfonamide |
| SMILES | C#CC(C)NS(=O)(=O)c1cc(N)c(OC)cc1OC |
| InChI | InChI=1S/C12H16N2O4S/c1-5-8(2)14-19(15,16)12-6-9(13)10(17-3)7-11(12)18-4/h1,6-8,14H,13H2,2-4H3 |
| InChIKey | CIHARPICXZMVBP-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|