C25H19N3O3 — CID 10294943
3-[5,6-bis(4-methoxyphenyl)pyridazin-3-yl]oxybenzonitrile (PubChem CID 10294943) has the molecular formula C25H19N3O3 and a molecular weight of 409.45 g/mol. Its IUPAC name is 3-[5,6-bis(4-methoxyphenyl)pyridazin-3-yl]oxybenzonitrile.
| Compound Name | 3-[5,6-bis(4-methoxyphenyl)pyridazin-3-yl]oxybenzonitrile |
|---|---|
| PubChem CID | 10294943 |
| Molecular Formula | C25H19N3O3 |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | 3-[5,6-bis(4-methoxyphenyl)pyridazin-3-yl]oxybenzonitrile |
| SMILES | COc1ccc(-c2cc(Oc3cccc(C#N)c3)nnc2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C25H19N3O3/c1-29-20-10-6-18(7-11-20)23-15-24(31-22-5-3-4-17(14-22)16-26)27-28-25(23)19-8-12-21(30-2)13-9-19/h3-15H,1-2H3 |
| InChIKey | LMVYLDPAAZWNLU-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 77.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |