C10H11F3N2O2 — CID 102950112
5,5,5-trifluoro-1-(6-methoxypyrimidin-4-yl)pentan-1-one (PubChem CID 102950112) has the molecular formula C10H11F3N2O2 and a molecular weight of 248.20 g/mol. Its IUPAC name is 5,5,5-trifluoro-1-(6-methoxypyrimidin-4-yl)pentan-1-one.
| Compound Name | 5,5,5-trifluoro-1-(6-methoxypyrimidin-4-yl)pentan-1-one |
|---|---|
| PubChem CID | 102950112 |
| Molecular Formula | C10H11F3N2O2 |
| Molecular Weight | 248.20 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 5,5,5-trifluoro-1-(6-methoxypyrimidin-4-yl)pentan-1-one |
| SMILES | COc1cc(C(=O)CCCC(F)(F)F)ncn1 |
| InChI | InChI=1S/C10H11F3N2O2/c1-17-9-5-7(14-6-15-9)8(16)3-2-4-10(11,12)13/h5-6H,2-4H2,1H3 |
| InChIKey | XNUPNSNGKIWYTQ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.20 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |