C24H20N4O3 — CID 10295152
N-[(11R)-3-hydroxy-6-methyl-12-oxo-9-phenyl-1,10-diazatricyclo[6.4.1.04,13]trideca-4(13),5,7,9-tetraen-11-yl]pyridine-4-carboxamide (PubChem CID 10295152) has the molecular formula C24H20N4O3 and a molecular weight of 412.45 g/mol. Its IUPAC name is N-[(11R)-3-hydroxy-6-methyl-12-oxo-9-phenyl-1,10-diazatricyclo[6.4.1.04,13]trideca-4(13),5,7,9-tetraen-11-yl]pyridine-4-carboxamide.
| Compound Name | N-[(11R)-3-hydroxy-6-methyl-12-oxo-9-phenyl-1,10-diazatricyclo[6.4.1.04,13]trideca-4(13),5,7,9-tetraen-11-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 10295152 |
| Molecular Formula | C24H20N4O3 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | N-[(11R)-3-hydroxy-6-methyl-12-oxo-9-phenyl-1,10-diazatricyclo[6.4.1.04,13]trideca-4(13),5,7,9-tetraen-11-yl]pyridine-4-carboxamide |
| SMILES | Cc1cc2c3c(c1)C(O)CN3C(=O)[C@H](NC(=O)c1ccncc1)N=C2c1ccccc1 |
| InChI | InChI=1S/C24H20N4O3/c1-14-11-17-19(29)13-28-21(17)18(12-14)20(15-5-3-2-4-6-15)26-22(24(28)31)27-23(30)16-7-9-25-10-8-16/h2-12,19,22,29H,13H2,1H3,(H,27,30)/t19?,22-/m0/s1 |
| InChIKey | UOZLGPJDXFFYJK-BPARTEKVSA-N |
| XLogP | 2.38 |
| TPSA | 94.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |